C19H19ClFN3OS — CID 71897158
(6-fluoroquinolin-8-yl)methyl N'-[(2-methoxyphenyl)methyl]carbamimidothioate;hydrochloride (PubChem CID 71897158) has the molecular formula C19H19ClFN3OS and a molecular weight of 391.90 g/mol. Its IUPAC name is (6-fluoroquinolin-8-yl)methyl N'-[(2-methoxyphenyl)methyl]carbamimidothioate;hydrochloride.
| Compound Name | (6-fluoroquinolin-8-yl)methyl N'-[(2-methoxyphenyl)methyl]carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 71897158 |
| Molecular Formula | C19H19ClFN3OS |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (6-fluoroquinolin-8-yl)methyl N'-[(2-methoxyphenyl)methyl]carbamimidothioate;hydrochloride |
| SMILES | COc1ccccc1C/N=C(\N)SCc1cc(F)cc2cccnc12.Cl |
| InChI | InChI=1S/C19H18FN3OS.ClH/c1-24-17-7-3-2-5-14(17)11-23-19(21)25-12-15-10-16(20)9-13-6-4-8-22-18(13)15;/h2-10H,11-12H2,1H3,(H2,21,23);1H |
| InChIKey | QBSQNWNTRIKAKY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|