C12H18N2O2S — CID 2473500
2-(4-methoxyphenoxy)ethyl N,N'-dimethylcarbamimidothioate (PubChem CID 2473500) has the molecular formula C12H18N2O2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl N,N'-dimethylcarbamimidothioate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 2473500 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C12H18N2O2S/c1-13-12(14-2)17-9-8-16-11-6-4-10(15-3)5-7-11/h4-7H,8-9H2,1-3H3,(H,13,14) |
| InChIKey | HBYXLFVZTXCFCB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|