C14H18N4O5 — CID 87131224
2-amino-3-[4-[[4-(carbamoylamino)-3-oxobutanoyl]amino]phenyl]propanoic acid (PubChem CID 87131224) has the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-amino-3-[4-[[4-(carbamoylamino)-3-oxobutanoyl]amino]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[[4-(carbamoylamino)-3-oxobutanoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 87131224 |
| Molecular Formula | C14H18N4O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-amino-3-[4-[[4-(carbamoylamino)-3-oxobutanoyl]amino]phenyl]propanoic acid |
| SMILES | NC(=O)NCC(=O)CC(=O)Nc1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C14H18N4O5/c15-11(13(21)22)5-8-1-3-9(4-2-8)18-12(20)6-10(19)7-17-14(16)23/h1-4,11H,5-7,15H2,(H,18,20)(H,21,22)(H3,16,17,23) |
| InChIKey | LNBXGGPOKRXHGJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|