C14H22N2O3 — CID 145486712
2-amino-3-[4-(2-oxopropylamino)phenyl]propanoic acid;ethane (PubChem CID 145486712) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-amino-3-[4-(2-oxopropylamino)phenyl]propanoic acid;ethane.
| Compound Name | 2-amino-3-[4-(2-oxopropylamino)phenyl]propanoic acid;ethane |
|---|---|
| PubChem CID | 145486712 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-amino-3-[4-(2-oxopropylamino)phenyl]propanoic acid;ethane |
| SMILES | CC.CC(=O)CNc1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C12H16N2O3.C2H6/c1-8(15)7-14-10-4-2-9(3-5-10)6-11(13)12(16)17;1-2/h2-5,11,14H,6-7,13H2,1H3,(H,16,17);1-2H3 |
| InChIKey | WCPOWTKCUUSULL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |