C18H20N2O5 — CID 68754922
(2S)-2-amino-3-[4-[[2-(4-hydroxyanilino)acetyl]oxymethyl]phenyl]propanoic acid (PubChem CID 68754922) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[[2-(4-hydroxyanilino)acetyl]oxymethyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[[2-(4-hydroxyanilino)acetyl]oxymethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68754922 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2S)-2-amino-3-[4-[[2-(4-hydroxyanilino)acetyl]oxymethyl]phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(COC(=O)CNc2ccc(O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C18H20N2O5/c19-16(18(23)24)9-12-1-3-13(4-2-12)11-25-17(22)10-20-14-5-7-15(21)8-6-14/h1-8,16,20-21H,9-11,19H2,(H,23,24)/t16-/m0/s1 |
| InChIKey | CJCNLSJPJLAPSH-INIZCTEOSA-N |
| XLogP | 1.50 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|