C38H48N4O10 — CID 160573488
2-amino-3-[4-(3-oxobutanoyl)phenyl]propanoic acid;2-amino-3-[4-(3-oxobutyl)phenyl]propanoic acid;2-amino-3-[4-(2-oxopropylamino)phenyl]propanoic acid (PubChem CID 160573488) has the molecular formula C38H48N4O10 and a molecular weight of 720.82 g/mol. Its IUPAC name is 2-amino-3-[4-(3-oxobutanoyl)phenyl]propanoic acid;2-amino-3-[4-(3-oxobutyl)phenyl]propanoic acid;2-amino-3-[4-(2-oxopropylamino)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-(3-oxobutanoyl)phenyl]propanoic acid;2-amino-3-[4-(3-oxobutyl)phenyl]propanoic acid;2-amino-3-[4-(2-oxopropylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 160573488 |
| Molecular Formula | C38H48N4O10 |
| Molecular Weight | 720.82 g/mol |
| Exact Mass | 720.34 |
| IUPAC Name | 2-amino-3-[4-(3-oxobutanoyl)phenyl]propanoic acid;2-amino-3-[4-(3-oxobutyl)phenyl]propanoic acid;2-amino-3-[4-(2-oxopropylamino)phenyl]propanoic acid |
| SMILES | CC(=O)CC(=O)c1ccc(CC(N)C(=O)O)cc1.CC(=O)CCc1ccc(CC(N)C(=O)O)cc1.CC(=O)CNc1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO4.C13H17NO3.C12H16N2O3/c1-8(15)6-12(16)10-4-2-9(3-5-10)7-11(14)13(17)18;1-9(15)2-3-10-4-6-11(7-5-10)8-12(14)13(16)17;1-8(15)7-14-10-4-2-9(3-5-10)6-11(13)12(16)17/h2-5,11H,6-7,14H2,1H3,(H,17,18);4-7,12H,2-3,8,14H2,1H3,(H,16,17);2-5,11,14H,6-7,13H2,1H3,(H,16,17) |
| InChIKey | RAVMMFLPPUEVKQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 270.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|