C14H21IN2O4S — CID 155319696
2-amino-3-[4-(5-iodopentylsulfonylamino)phenyl]propanoic acid (PubChem CID 155319696) has the molecular formula C14H21IN2O4S and a molecular weight of 440.30 g/mol. Its IUPAC name is 2-amino-3-[4-(5-iodopentylsulfonylamino)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-(5-iodopentylsulfonylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 155319696 |
| Molecular Formula | C14H21IN2O4S |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 2-amino-3-[4-(5-iodopentylsulfonylamino)phenyl]propanoic acid |
| SMILES | NC(Cc1ccc(NS(=O)(=O)CCCCCI)cc1)C(=O)O |
| InChI | InChI=1S/C14H21IN2O4S/c15-8-2-1-3-9-22(20,21)17-12-6-4-11(5-7-12)10-13(16)14(18)19/h4-7,13,17H,1-3,8-10,16H2,(H,18,19) |
| InChIKey | XTFGPEZPIGUDOU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|