C10H12N2O3S — CID 155708158
4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]benzoic acid (PubChem CID 155708158) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 155708158 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]benzoic acid |
| SMILES | N[C@@H](CS)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C10H12N2O3S/c11-8(5-16)9(13)12-7-3-1-6(2-4-7)10(14)15/h1-4,8,16H,5,11H2,(H,12,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | QVLNHYGVJXGMDA-QMMMGPOBSA-N |
| XLogP | 0.58 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|