C11H11KN2O5 — CID 70303012
potassium 4-[[(2S)-2-amino-3-carboxypropanoyl]amino]benzoate (PubChem CID 70303012) has the molecular formula C11H11KN2O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is potassium 4-[[(2S)-2-amino-3-carboxypropanoyl]amino]benzoate.
| Compound Name | potassium 4-[[(2S)-2-amino-3-carboxypropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 70303012 |
| Molecular Formula | C11H11KN2O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | potassium 4-[[(2S)-2-amino-3-carboxypropanoyl]amino]benzoate |
| SMILES | N[C@@H](CC(=O)O)C(=O)Nc1ccc(C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C11H12N2O5.K/c12-8(5-9(14)15)10(16)13-7-3-1-6(2-4-7)11(17)18;/h1-4,8H,5,12H2,(H,13,16)(H,14,15)(H,17,18);/q;+1/p-1/t8-;/m0./s1 |
| InChIKey | NQAKELUIIYZFFT-QRPNPIFTSA-M |
| XLogP | -4.21 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |