C19H34N2O5PS2+ — CID 102340984
2-[[4-[6,8-bis(sulfanyl)octanoylamino]phenoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 102340984) has the molecular formula C19H34N2O5PS2+ and a molecular weight of 465.60 g/mol. Its IUPAC name is 2-[[4-[6,8-bis(sulfanyl)octanoylamino]phenoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[4-[6,8-bis(sulfanyl)octanoylamino]phenoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 102340984 |
| Molecular Formula | C19H34N2O5PS2+ |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-[[4-[6,8-bis(sulfanyl)octanoylamino]phenoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)Oc1ccc(NC(=O)CCCCC(S)CCS)cc1 |
| InChI | InChI=1S/C19H33N2O5PS2/c1-21(2,3)13-14-25-27(23,24)26-17-10-8-16(9-11-17)20-19(22)7-5-4-6-18(29)12-15-28/h8-11,18H,4-7,12-15H2,1-3H3,(H3-,20,22,23,24,28,29)/p+1 |
| InChIKey | SQZDWRQUDUIXFU-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|