C19H28N4O — CID 108885651
3-(2,3-dimethylquinoxalin-6-yl)-1,1-bis(2-methylpropyl)urea (PubChem CID 108885651) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-(2,3-dimethylquinoxalin-6-yl)-1,1-bis(2-methylpropyl)urea.
| Compound Name | 3-(2,3-dimethylquinoxalin-6-yl)-1,1-bis(2-methylpropyl)urea |
|---|---|
| PubChem CID | 108885651 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 3-(2,3-dimethylquinoxalin-6-yl)-1,1-bis(2-methylpropyl)urea |
| SMILES | Cc1nc2ccc(NC(=O)N(CC(C)C)CC(C)C)cc2nc1C |
| InChI | InChI=1S/C19H28N4O/c1-12(2)10-23(11-13(3)4)19(24)22-16-7-8-17-18(9-16)21-15(6)14(5)20-17/h7-9,12-13H,10-11H2,1-6H3,(H,22,24) |
| InChIKey | KOAFXYAQUJOUGZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |