C20H15Cl2N3O2S — CID 12912870
N-[(6-benzylsulfanyl-3-pyridinyl)carbamoyl]-2,6-dichlorobenzamide (PubChem CID 12912870) has the molecular formula C20H15Cl2N3O2S and a molecular weight of 432.33 g/mol. Its IUPAC name is N-[(6-benzylsulfanyl-3-pyridinyl)carbamoyl]-2,6-dichlorobenzamide.
| Compound Name | N-[(6-benzylsulfanyl-3-pyridinyl)carbamoyl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 12912870 |
| Molecular Formula | C20H15Cl2N3O2S |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | N-[(6-benzylsulfanyl-3-pyridinyl)carbamoyl]-2,6-dichlorobenzamide |
| SMILES | O=C(NC(=O)c1c(Cl)cccc1Cl)Nc1ccc(SCc2ccccc2)nc1 |
| InChI | InChI=1S/C20H15Cl2N3O2S/c21-15-7-4-8-16(22)18(15)19(26)25-20(27)24-14-9-10-17(23-11-14)28-12-13-5-2-1-3-6-13/h1-11H,12H2,(H2,24,25,26,27) |
| InChIKey | UCGIZPATBSWURU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |