C22H21N3O5 — CID 12912868
2,6-dimethoxy-N-[(6-phenylmethoxy-3-pyridinyl)carbamoyl]benzamide (PubChem CID 12912868) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[(6-phenylmethoxy-3-pyridinyl)carbamoyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[(6-phenylmethoxy-3-pyridinyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 12912868 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2,6-dimethoxy-N-[(6-phenylmethoxy-3-pyridinyl)carbamoyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=O)Nc1ccc(OCc2ccccc2)nc1 |
| InChI | InChI=1S/C22H21N3O5/c1-28-17-9-6-10-18(29-2)20(17)21(26)25-22(27)24-16-11-12-19(23-13-16)30-14-15-7-4-3-5-8-15/h3-13H,14H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | RBLOEDDKPDATMP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |