C15H8F4INO3 — CID 90691439
2-[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]-3-iodobenzoic acid (PubChem CID 90691439) has the molecular formula C15H8F4INO3 and a molecular weight of 453.13 g/mol. Its IUPAC name is 2-[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]-3-iodobenzoic acid.
| Compound Name | 2-[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]-3-iodobenzoic acid |
|---|---|
| PubChem CID | 90691439 |
| Molecular Formula | C15H8F4INO3 |
| Molecular Weight | 453.13 g/mol |
| Exact Mass | 452.95 |
| IUPAC Name | 2-[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]-3-iodobenzoic acid |
| SMILES | O=C(Nc1c(I)cccc1C(=O)O)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C15H8F4INO3/c16-10-6-7(15(17,18)19)4-5-8(10)13(22)21-12-9(14(23)24)2-1-3-11(12)20/h1-6H,(H,21,22)(H,23,24) |
| InChIKey | BHHSYNXENSLHRO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.13 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|