C14H20N2O — CID 110485487
N-butyl-1-methyl-2,3-dihydroindole-5-carboxamide (PubChem CID 110485487) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is N-butyl-1-methyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | N-butyl-1-methyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 110485487 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N-butyl-1-methyl-2,3-dihydroindole-5-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C14H20N2O/c1-3-4-8-15-14(17)12-5-6-13-11(10-12)7-9-16(13)2/h5-6,10H,3-4,7-9H2,1-2H3,(H,15,17) |
| InChIKey | FDXHZJSLANBHKO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|