C15H14N4O2 — CID 101076082
(1-methyl-2,3-dihydroindol-5-yl)-(4-nitrophenyl)diazene (PubChem CID 101076082) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is (1-methyl-2,3-dihydroindol-5-yl)-(4-nitrophenyl)diazene.
| Compound Name | (1-methyl-2,3-dihydroindol-5-yl)-(4-nitrophenyl)diazene |
|---|---|
| PubChem CID | 101076082 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (1-methyl-2,3-dihydroindol-5-yl)-(4-nitrophenyl)diazene |
| SMILES | CN1CCc2cc(/N=N/c3ccc([N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C15H14N4O2/c1-18-9-8-11-10-13(4-7-15(11)18)17-16-12-2-5-14(6-3-12)19(20)21/h2-7,10H,8-9H2,1H3/b17-16+ |
| InChIKey | JNHNJZGTFGEPGY-WUKNDPDISA-N |
| XLogP | 4.00 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|