C22H27N3O8 — CID 177442985
19-[(4-nitrophenyl)diazenyl]-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol (PubChem CID 177442985) has the molecular formula C22H27N3O8 and a molecular weight of 461.47 g/mol. Its IUPAC name is 19-[(4-nitrophenyl)diazenyl]-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol.
| Compound Name | 19-[(4-nitrophenyl)diazenyl]-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol |
|---|---|
| PubChem CID | 177442985 |
| Molecular Formula | C22H27N3O8 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 19-[(4-nitrophenyl)diazenyl]-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2cc3c(O)c(c2)COCCOCCOCCOCCOC3)cc1 |
| InChI | InChI=1S/C22H27N3O8/c26-22-17-13-20(24-23-19-1-3-21(4-2-19)25(27)28)14-18(22)16-33-12-10-31-8-6-29-5-7-30-9-11-32-15-17/h1-4,13-14,26H,5-12,15-16H2/b24-23+ |
| InChIKey | BTPOWMHYWSNEIF-WCWDXBQESA-N |
| XLogP | 3.81 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|