C19H19N5O3 — CID 7536166
(4-nitrophenyl)-[(5S)-1',3',3'-trimethylspiro[4H-1,2-oxazole-5,2'-indole]-5'-yl]diazene (PubChem CID 7536166) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is (4-nitrophenyl)-[(5S)-1',3',3'-trimethylspiro[4H-1,2-oxazole-5,2'-indole]-5'-yl]diazene.
| Compound Name | (4-nitrophenyl)-[(5S)-1',3',3'-trimethylspiro[4H-1,2-oxazole-5,2'-indole]-5'-yl]diazene |
|---|---|
| PubChem CID | 7536166 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (4-nitrophenyl)-[(5S)-1',3',3'-trimethylspiro[4H-1,2-oxazole-5,2'-indole]-5'-yl]diazene |
| SMILES | CN1c2ccc(/N=N/c3ccc([N+](=O)[O-])cc3)cc2C(C)(C)[C@@]12CC=NO2 |
| InChI | InChI=1S/C19H19N5O3/c1-18(2)16-12-14(22-21-13-4-7-15(8-5-13)24(25)26)6-9-17(16)23(3)19(18)10-11-20-27-19/h4-9,11-12H,10H2,1-3H3/b22-21+/t19-/m0/s1 |
| InChIKey | OMQJTJLMCAGFOH-XJUMHSELSA-N |
| XLogP | 4.84 |
| TPSA | 92.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|