C9H11NO3S — CID 57117417
1-methyl-2,3-dihydroindole-5-sulfonic acid (PubChem CID 57117417) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is 1-methyl-2,3-dihydroindole-5-sulfonic acid.
| Compound Name | 1-methyl-2,3-dihydroindole-5-sulfonic acid |
|---|---|
| PubChem CID | 57117417 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 1-methyl-2,3-dihydroindole-5-sulfonic acid |
| SMILES | CN1CCc2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C9H11NO3S/c1-10-5-4-7-6-8(14(11,12)13)2-3-9(7)10/h2-3,6H,4-5H2,1H3,(H,11,12,13) |
| InChIKey | XRIFQZNKHKBMOZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|