C20H34N2O2 — CID 46194745
2-amino-2-[(5-octyl-2,3-dihydroindol-1-yl)methyl]propane-1,3-diol (PubChem CID 46194745) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is 2-amino-2-[(5-octyl-2,3-dihydroindol-1-yl)methyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[(5-octyl-2,3-dihydroindol-1-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 46194745 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | 2-amino-2-[(5-octyl-2,3-dihydroindol-1-yl)methyl]propane-1,3-diol |
| SMILES | CCCCCCCCc1ccc2c(c1)CCN2CC(N)(CO)CO |
| InChI | InChI=1S/C20H34N2O2/c1-2-3-4-5-6-7-8-17-9-10-19-18(13-17)11-12-22(19)14-20(21,15-23)16-24/h9-10,13,23-24H,2-8,11-12,14-16,21H2,1H3 |
| InChIKey | BHCXQGNHXHEAFU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|