C22H37NO — CID 25018299
2-amino-2-(2-octyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)propan-1-ol (PubChem CID 25018299) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is 2-amino-2-(2-octyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)propan-1-ol.
| Compound Name | 2-amino-2-(2-octyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)propan-1-ol |
|---|---|
| PubChem CID | 25018299 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | 2-amino-2-(2-octyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)propan-1-ol |
| SMILES | CCCCCCCCc1ccc2c(c1)CCCC(C(C)(N)CO)C2 |
| InChI | InChI=1S/C22H37NO/c1-3-4-5-6-7-8-10-18-13-14-20-16-21(22(2,23)17-24)12-9-11-19(20)15-18/h13-15,21,24H,3-12,16-17,23H2,1-2H3 |
| InChIKey | XWSBGJGFRSDUJI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|