C23H37NO3 — CID 98052612
N-[1,3-dihydroxy-2-[(2R)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-yl]acetamide (PubChem CID 98052612) has the molecular formula C23H37NO3 and a molecular weight of 375.55 g/mol. Its IUPAC name is N-[1,3-dihydroxy-2-[(2R)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-yl]acetamide.
| Compound Name | N-[1,3-dihydroxy-2-[(2R)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 98052612 |
| Molecular Formula | C23H37NO3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | N-[1,3-dihydroxy-2-[(2R)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-yl]acetamide |
| SMILES | CCCCCCCCc1ccc2c(c1)CC[C@@H](C(CO)(CO)NC(C)=O)C2 |
| InChI | InChI=1S/C23H37NO3/c1-3-4-5-6-7-8-9-19-10-11-21-15-22(13-12-20(21)14-19)23(16-25,17-26)24-18(2)27/h10-11,14,22,25-26H,3-9,12-13,15-17H2,1-2H3,(H,24,27)/t22-/m1/s1 |
| InChIKey | QGEYCNBEQMCZFK-JOCHJYFZSA-N |
| XLogP | 3.55 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|