C27H41NO5 — CID 98052609
diethyl 2-acetamido-2-[(2S)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanedioate (PubChem CID 98052609) has the molecular formula C27H41NO5 and a molecular weight of 459.63 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(2S)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(2S)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanedioate |
|---|---|
| PubChem CID | 98052609 |
| Molecular Formula | C27H41NO5 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | diethyl 2-acetamido-2-[(2S)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanedioate |
| SMILES | CCCCCCCCc1ccc2c(c1)CC[C@H](C(NC(C)=O)(C(=O)OCC)C(=O)OCC)C2 |
| InChI | InChI=1S/C27H41NO5/c1-5-8-9-10-11-12-13-21-14-15-23-19-24(17-16-22(23)18-21)27(28-20(4)29,25(30)32-6-2)26(31)33-7-3/h14-15,18,24H,5-13,16-17,19H2,1-4H3,(H,28,29)/t24-/m0/s1 |
| InChIKey | UUIXORUKKVDZKH-DEOSSOPVSA-N |
| XLogP | 4.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|