C26H38O5 — CID 67541706
3-butan-2-yloxy-2-methyl-2-(6-octyl-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)-3-oxopropanoic acid (PubChem CID 67541706) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is 3-butan-2-yloxy-2-methyl-2-(6-octyl-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)-3-oxopropanoic acid.
| Compound Name | 3-butan-2-yloxy-2-methyl-2-(6-octyl-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 67541706 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 3-butan-2-yloxy-2-methyl-2-(6-octyl-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)-3-oxopropanoic acid |
| SMILES | CCCCCCCCc1ccc2c(c1)CCC(C(C)(C(=O)O)C(=O)OC(C)CC)C2=O |
| InChI | InChI=1S/C26H38O5/c1-5-7-8-9-10-11-12-19-13-15-21-20(17-19)14-16-22(23(21)27)26(4,24(28)29)25(30)31-18(3)6-2/h13,15,17-18,22H,5-12,14,16H2,1-4H3,(H,28,29) |
| InChIKey | FFJBGJCANDNIKT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|