C21H37NO5P+ — CID 70846424
[2-amino-3-hydroxy-2-[(2R)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propoxy]-trihydroxyphosphanium (PubChem CID 70846424) has the molecular formula C21H37NO5P+ and a molecular weight of 414.50 g/mol. Its IUPAC name is [2-amino-3-hydroxy-2-[(2R)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propoxy]-trihydroxyphosphanium.
| Compound Name | [2-amino-3-hydroxy-2-[(2R)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propoxy]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 70846424 |
| Molecular Formula | C21H37NO5P+ |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | [2-amino-3-hydroxy-2-[(2R)-6-octyl-1,2,3,4-tetrahydronaphthalen-2-yl]propoxy]-trihydroxyphosphanium |
| SMILES | CCCCCCCCc1ccc2c(c1)CC[C@@H](C(N)(CO)CO[P+](O)(O)O)C2 |
| InChI | InChI=1S/C21H37NO5P/c1-2-3-4-5-6-7-8-17-9-10-19-14-20(12-11-18(19)13-17)21(22,15-23)16-27-28(24,25)26/h9-10,13,20,23-26H,2-8,11-12,14-16,22H2,1H3/q+1/t20-,21?/m1/s1 |
| InChIKey | BFIWKNFKPPTOAW-VQCQRNETSA-N |
| XLogP | 3.06 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|