C24H23NO — CID 139659265
1-oxo-6-[2-(4-pentylphenyl)ethynyl]-3,4-dihydro-2H-naphthalene-2-carbonitrile (PubChem CID 139659265) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-oxo-6-[2-(4-pentylphenyl)ethynyl]-3,4-dihydro-2H-naphthalene-2-carbonitrile.
| Compound Name | 1-oxo-6-[2-(4-pentylphenyl)ethynyl]-3,4-dihydro-2H-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139659265 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-oxo-6-[2-(4-pentylphenyl)ethynyl]-3,4-dihydro-2H-naphthalene-2-carbonitrile |
| SMILES | CCCCCc1ccc(C#Cc2ccc3c(c2)CCC(C#N)C3=O)cc1 |
| InChI | InChI=1S/C24H23NO/c1-2-3-4-5-18-6-8-19(9-7-18)10-11-20-12-15-23-21(16-20)13-14-22(17-25)24(23)26/h6-9,12,15-16,22H,2-5,13-14H2,1H3 |
| InChIKey | ALNVTLIDRJROMJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|