C12H17NO — CID 105445307
2-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)ethanol (PubChem CID 105445307) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)ethanol.
| Compound Name | 2-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)ethanol |
|---|---|
| PubChem CID | 105445307 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)ethanol |
| SMILES | CN1CCc2cc(CCO)ccc2C1 |
| InChI | InChI=1S/C12H17NO/c1-13-6-4-11-8-10(5-7-14)2-3-12(11)9-13/h2-3,8,14H,4-7,9H2,1H3 |
| InChIKey | FNWOKPUYOXSNPY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |