C11H16NP — CID 155201597
(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methylphosphane (PubChem CID 155201597) has the molecular formula C11H16NP and a molecular weight of 193.23 g/mol. Its IUPAC name is (2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methylphosphane.
| Compound Name | (2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methylphosphane |
|---|---|
| PubChem CID | 155201597 |
| Molecular Formula | C11H16NP |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methylphosphane |
| SMILES | CN1CCc2cc(CP)ccc2C1 |
| InChI | InChI=1S/C11H16NP/c1-12-5-4-10-6-9(8-13)2-3-11(10)7-12/h2-3,6H,4-5,7-8,13H2,1H3 |
| InChIKey | BFFCSYKSPSREMC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|