C20H24N2 — CID 155698227
buta-1,3-diene;2-methyl-6-(pyridin-3-ylmethyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 155698227) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is buta-1,3-diene;2-methyl-6-(pyridin-3-ylmethyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | buta-1,3-diene;2-methyl-6-(pyridin-3-ylmethyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 155698227 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | buta-1,3-diene;2-methyl-6-(pyridin-3-ylmethyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | C=CC=C.CN1CCc2cc(Cc3cccnc3)ccc2C1 |
| InChI | InChI=1S/C16H18N2.C4H6/c1-18-8-6-15-10-13(4-5-16(15)12-18)9-14-3-2-7-17-11-14;1-3-4-2/h2-5,7,10-11H,6,8-9,12H2,1H3;3-4H,1-2H2 |
| InChIKey | BGBMDEJHPWFIBF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|