C15H16N2O — CID 118567165
1-methyl-6-(pyridin-3-ylmethoxy)-2,3-dihydroindole (PubChem CID 118567165) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-methyl-6-(pyridin-3-ylmethoxy)-2,3-dihydroindole.
| Compound Name | 1-methyl-6-(pyridin-3-ylmethoxy)-2,3-dihydroindole |
|---|---|
| PubChem CID | 118567165 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-methyl-6-(pyridin-3-ylmethoxy)-2,3-dihydroindole |
| SMILES | CN1CCc2ccc(OCc3cccnc3)cc21 |
| InChI | InChI=1S/C15H16N2O/c1-17-8-6-13-4-5-14(9-15(13)17)18-11-12-3-2-7-16-10-12/h2-5,7,9-10H,6,8,11H2,1H3 |
| InChIKey | QWLCOQWTLGXSIC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |