C14H14ClNO — CID 112828338
3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine (PubChem CID 112828338) has the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. Its IUPAC name is 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine.
| Compound Name | 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 112828338 |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 3-[(4-chloro-3,5-dimethylphenoxy)methyl]pyridine |
| SMILES | Cc1cc(OCc2cccnc2)cc(C)c1Cl |
| InChI | InChI=1S/C14H14ClNO/c1-10-6-13(7-11(2)14(10)15)17-9-12-4-3-5-16-8-12/h3-8H,9H2,1-2H3 |
| InChIKey | XQKRIMXLDYSTBN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |