C17H16N2O3 — CID 170299537
1,7-dimethyl-5-(pyridin-3-ylmethoxy)indole-2-carboxylic acid (PubChem CID 170299537) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1,7-dimethyl-5-(pyridin-3-ylmethoxy)indole-2-carboxylic acid.
| Compound Name | 1,7-dimethyl-5-(pyridin-3-ylmethoxy)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 170299537 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1,7-dimethyl-5-(pyridin-3-ylmethoxy)indole-2-carboxylic acid |
| SMILES | Cc1cc(OCc2cccnc2)cc2cc(C(=O)O)n(C)c12 |
| InChI | InChI=1S/C17H16N2O3/c1-11-6-14(22-10-12-4-3-5-18-9-12)7-13-8-15(17(20)21)19(2)16(11)13/h3-9H,10H2,1-2H3,(H,20,21) |
| InChIKey | QDXKSCCQUJMQKI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |