C14H16N2O — CID 63690803
3,5-dimethyl-4-(pyridin-3-ylmethoxy)aniline (PubChem CID 63690803) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 3,5-dimethyl-4-(pyridin-3-ylmethoxy)aniline.
| Compound Name | 3,5-dimethyl-4-(pyridin-3-ylmethoxy)aniline |
|---|---|
| PubChem CID | 63690803 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3,5-dimethyl-4-(pyridin-3-ylmethoxy)aniline |
| SMILES | Cc1cc(N)cc(C)c1OCc1cccnc1 |
| InChI | InChI=1S/C14H16N2O/c1-10-6-13(15)7-11(2)14(10)17-9-12-4-3-5-16-8-12/h3-8H,9,15H2,1-2H3 |
| InChIKey | CTSMBWUTJLFDNV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|