C17H20N2OS — CID 144549825
methanethioamide;1-methyl-5-phenylmethoxy-2,3-dihydroindole (PubChem CID 144549825) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is methanethioamide;1-methyl-5-phenylmethoxy-2,3-dihydroindole.
| Compound Name | methanethioamide;1-methyl-5-phenylmethoxy-2,3-dihydroindole |
|---|---|
| PubChem CID | 144549825 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | methanethioamide;1-methyl-5-phenylmethoxy-2,3-dihydroindole |
| SMILES | CN1CCc2cc(OCc3ccccc3)ccc21.NC=S |
| InChI | InChI=1S/C16H17NO.CH3NS/c1-17-10-9-14-11-15(7-8-16(14)17)18-12-13-5-3-2-4-6-13;2-1-3/h2-8,11H,9-10,12H2,1H3;1H,(H2,2,3) |
| InChIKey | LDLRYCRJVMUUNX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|