C26H29NO6S — CID 130247124
4-methylbenzenesulfonic acid;methyl 3-(6-phenylmethoxy-2,3-dihydroindol-1-yl)propanoate (PubChem CID 130247124) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;methyl 3-(6-phenylmethoxy-2,3-dihydroindol-1-yl)propanoate.
| Compound Name | 4-methylbenzenesulfonic acid;methyl 3-(6-phenylmethoxy-2,3-dihydroindol-1-yl)propanoate |
|---|---|
| PubChem CID | 130247124 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 4-methylbenzenesulfonic acid;methyl 3-(6-phenylmethoxy-2,3-dihydroindol-1-yl)propanoate |
| SMILES | COC(=O)CCN1CCc2ccc(OCc3ccccc3)cc21.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H21NO3.C7H8O3S/c1-22-19(21)10-12-20-11-9-16-7-8-17(13-18(16)20)23-14-15-5-3-2-4-6-15;1-6-2-4-7(5-3-6)11(8,9)10/h2-8,13H,9-12,14H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | PMKKCZQDTVJTLG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|