C24H25NO7S — CID 25158678
dimethyl (2R)-2-[(6-phenylmethoxynaphthalen-2-yl)sulfonylamino]pentanedioate (PubChem CID 25158678) has the molecular formula C24H25NO7S and a molecular weight of 471.53 g/mol. Its IUPAC name is dimethyl (2R)-2-[(6-phenylmethoxynaphthalen-2-yl)sulfonylamino]pentanedioate.
| Compound Name | dimethyl (2R)-2-[(6-phenylmethoxynaphthalen-2-yl)sulfonylamino]pentanedioate |
|---|---|
| PubChem CID | 25158678 |
| Molecular Formula | C24H25NO7S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | dimethyl (2R)-2-[(6-phenylmethoxynaphthalen-2-yl)sulfonylamino]pentanedioate |
| SMILES | COC(=O)CC[C@@H](NS(=O)(=O)c1ccc2cc(OCc3ccccc3)ccc2c1)C(=O)OC |
| InChI | InChI=1S/C24H25NO7S/c1-30-23(26)13-12-22(24(27)31-2)25-33(28,29)21-11-9-18-14-20(10-8-19(18)15-21)32-16-17-6-4-3-5-7-17/h3-11,14-15,22,25H,12-13,16H2,1-2H3/t22-/m1/s1 |
| InChIKey | VFQFDCKWUTXJGA-JOCHJYFZSA-N |
| XLogP | 3.19 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |