C13H17F2N — CID 174880450
6-(difluoromethyl)-1-(2-methylpropyl)-2,3-dihydroindole (PubChem CID 174880450) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is 6-(difluoromethyl)-1-(2-methylpropyl)-2,3-dihydroindole.
| Compound Name | 6-(difluoromethyl)-1-(2-methylpropyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 174880450 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 6-(difluoromethyl)-1-(2-methylpropyl)-2,3-dihydroindole |
| SMILES | CC(C)CN1CCc2ccc(C(F)F)cc21 |
| InChI | InChI=1S/C13H17F2N/c1-9(2)8-16-6-5-10-3-4-11(13(14)15)7-12(10)16/h3-4,7,9,13H,5-6,8H2,1-2H3 |
| InChIKey | WIVFNWGAUCAZLU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |