C16H15NO3S — CID 46807431
1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-2,3-dihydroindole (PubChem CID 46807431) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-2,3-dihydroindole.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 46807431 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-2,3-dihydroindole |
| SMILES | O=S(=O)(c1ccc2c(c1)CCO2)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H15NO3S/c18-21(19,14-5-6-16-13(11-14)8-10-20-16)17-9-7-12-3-1-2-4-15(12)17/h1-6,11H,7-10H2 |
| InChIKey | NYOHPTUOOQSPTC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |