C17H18N2O2S — CID 22692421
6-(2,3-dihydroindol-1-ylsulfonyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 22692421) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 6-(2,3-dihydroindol-1-ylsulfonyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(2,3-dihydroindol-1-ylsulfonyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 22692421 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 6-(2,3-dihydroindol-1-ylsulfonyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | O=S(=O)(c1ccc2c(c1)CCCN2)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H18N2O2S/c20-22(21,19-11-9-13-4-1-2-6-17(13)19)15-7-8-16-14(12-15)5-3-10-18-16/h1-2,4,6-8,12,18H,3,5,9-11H2 |
| InChIKey | IYULWCIQRDOBCH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |