C19H23BN2O4 — CID 20651358
[3-[[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]methyl]phenyl]boronic acid (PubChem CID 20651358) has the molecular formula C19H23BN2O4 and a molecular weight of 354.22 g/mol. Its IUPAC name is [3-[[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [3-[[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 20651358 |
| Molecular Formula | C19H23BN2O4 |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [3-[[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]methyl]phenyl]boronic acid |
| SMILES | OB(O)c1cccc(CN2CCN(c3cccc4c3OCCO4)CC2)c1 |
| InChI | InChI=1S/C19H23BN2O4/c23-20(24)16-4-1-3-15(13-16)14-21-7-9-22(10-8-21)17-5-2-6-18-19(17)26-12-11-25-18/h1-6,13,23-24H,7-12,14H2 |
| InChIKey | YJTAIPZGUVIINM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|