C13H21BN2O2 — CID 54971146
[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid (PubChem CID 54971146) has the molecular formula C13H21BN2O2 and a molecular weight of 248.14 g/mol. Its IUPAC name is [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid.
| Compound Name | [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 54971146 |
| Molecular Formula | C13H21BN2O2 |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid |
| SMILES | CN1CCCN(Cc2cccc(B(O)O)c2)CC1 |
| InChI | InChI=1S/C13H21BN2O2/c1-15-6-3-7-16(9-8-15)11-12-4-2-5-13(10-12)14(17)18/h2,4-5,10,17-18H,3,6-9,11H2,1H3 |
| InChIKey | GZSCMOCHPPHWNZ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|