[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid

C13H21BN2O2 — CID 54971146

IUPAC[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid
SMILESCN1CCCN(Cc2cccc(B(O)O)c2)CC1
InChIInChI=1S/C13H21BN2O2/c1-15-6-3-7-16(9-8-15)11-12-4-2-5-13(10-12)14(17)18/h2,4-5,10,17-18H,3,6-9,11H2,1H3
InChIKeyGZSCMOCHPPHWNZ-UHFFFAOYSA-N
MW248.14 g/mol
LogP-0.50
Rot. Bonds3

About [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid

[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid (PubChem CID 54971146) has the molecular formula C13H21BN2O2 and a molecular weight of 248.14 g/mol. Its IUPAC name is [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid.

Molecular Properties

Compound Name[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid
PubChem CID54971146
Molecular FormulaC13H21BN2O2
Molecular Weight248.14 g/mol
Exact Mass248.17
IUPAC Name[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid
SMILESCN1CCCN(Cc2cccc(B(O)O)c2)CC1
InChIInChI=1S/C13H21BN2O2/c1-15-6-3-7-16(9-8-15)11-12-4-2-5-13(10-12)14(17)18/h2,4-5,10,17-18H,3,6-9,11H2,1H3
InChIKeyGZSCMOCHPPHWNZ-UHFFFAOYSA-N
XLogP-0.50
TPSA46.94 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.14
LogP ≤ 5-0.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid?
The IUPAC name of [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid (CID 54971146) is [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid.
What is the SMILES notation for [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid?
The canonical SMILES for [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid is CN1CCCN(Cc2cccc(B(O)O)c2)CC1.
What is the InChIKey of [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid?
The InChIKey is GZSCMOCHPPHWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21BN2O2/c1-15-6-3-7-16(9-8-15)11-12-4-2-5-13(10-12)14(17)18/h2,4-5,10,17-18H,3,6-9,11H2,1H3.
What are the key properties of [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid?
[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid has a molecular weight of 248.14 g/mol, XLogP of -0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]boronic acid is sourced from PubChem (CID 54971146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).