C14H23BN2O2 — CID 62888648
[3-[[2-[(dimethylamino)methyl]pyrrolidin-1-yl]methyl]phenyl]boronic acid (PubChem CID 62888648) has the molecular formula C14H23BN2O2 and a molecular weight of 262.16 g/mol. Its IUPAC name is [3-[[2-[(dimethylamino)methyl]pyrrolidin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [3-[[2-[(dimethylamino)methyl]pyrrolidin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 62888648 |
| Molecular Formula | C14H23BN2O2 |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | [3-[[2-[(dimethylamino)methyl]pyrrolidin-1-yl]methyl]phenyl]boronic acid |
| SMILES | CN(C)CC1CCCN1Cc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C14H23BN2O2/c1-16(2)11-14-7-4-8-17(14)10-12-5-3-6-13(9-12)15(18)19/h3,5-6,9,14,18-19H,4,7-8,10-11H2,1-2H3 |
| InChIKey | HOQUDLGJFAXHMR-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|