C12H14O2S — CID 78827161
7-prop-2-enylsulfanyl-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 78827161) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is 7-prop-2-enylsulfanyl-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-prop-2-enylsulfanyl-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 78827161 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 7-prop-2-enylsulfanyl-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | C=CCSc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C12H14O2S/c1-2-8-15-10-4-5-11-12(9-10)14-7-3-6-13-11/h2,4-5,9H,1,3,6-8H2 |
| InChIKey | XBJUNBQTNKQTCL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|