C12H13BF3KO2S — CID 106747077
potassium 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106747077) has the molecular formula C12H13BF3KO2S and a molecular weight of 328.21 g/mol. Its IUPAC name is potassium 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | potassium 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106747077 |
| Molecular Formula | C12H13BF3KO2S |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | potassium 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CSc1ccc2c(c1)OCCCO2)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C12H13BF3O2S.K/c1-9(13(14,15)16)8-19-10-3-4-11-12(7-10)18-6-2-5-17-11;/h3-4,7H,1-2,5-6,8H2;/q-1;+1 |
| InChIKey | OCMCJDGWVOZYJO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|