C13H15ClO2S — CID 103066331
7-[2-(chloromethyl)prop-2-enylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 103066331) has the molecular formula C13H15ClO2S and a molecular weight of 270.78 g/mol. Its IUPAC name is 7-[2-(chloromethyl)prop-2-enylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-[2-(chloromethyl)prop-2-enylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 103066331 |
| Molecular Formula | C13H15ClO2S |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 7-[2-(chloromethyl)prop-2-enylsulfanyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | C=C(CCl)CSc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H15ClO2S/c1-10(8-14)9-17-11-3-4-12-13(7-11)16-6-2-5-15-12/h3-4,7H,1-2,5-6,8-9H2 |
| InChIKey | FRVACIXECZVDRV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|