C9H7BF5S- — CID 106746970
3-(3,4-difluorophenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746970) has the molecular formula C9H7BF5S- and a molecular weight of 253.02 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-(3,4-difluorophenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746970 |
| Molecular Formula | C9H7BF5S- |
| Molecular Weight | 253.02 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 3-(3,4-difluorophenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CSc1ccc(F)c(F)c1)[B-](F)(F)F |
| InChI | InChI=1S/C9H7BF5S/c1-6(10(13,14)15)5-16-7-2-3-8(11)9(12)4-7/h2-4H,1,5H2/q-1 |
| InChIKey | MNGSKXCSNQEYMQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.02 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|