C13H18O3S2 — CID 113318652
2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)ethoxy]ethanethiol (PubChem CID 113318652) has the molecular formula C13H18O3S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)ethoxy]ethanethiol.
| Compound Name | 2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)ethoxy]ethanethiol |
|---|---|
| PubChem CID | 113318652 |
| Molecular Formula | C13H18O3S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)ethoxy]ethanethiol |
| SMILES | SCCOCCSc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H18O3S2/c17-8-6-14-7-9-18-11-2-3-12-13(10-11)16-5-1-4-15-12/h2-3,10,17H,1,4-9H2 |
| InChIKey | FUUKDJJHDDJNMD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|