C12H14O2S2 — CID 115479514
(E)-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)but-2-ene-1-thiol (PubChem CID 115479514) has the molecular formula C12H14O2S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (E)-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)but-2-ene-1-thiol.
| Compound Name | (E)-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)but-2-ene-1-thiol |
|---|---|
| PubChem CID | 115479514 |
| Molecular Formula | C12H14O2S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | (E)-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)but-2-ene-1-thiol |
| SMILES | SC/C=C/CSc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H14O2S2/c15-7-1-2-8-16-10-3-4-11-12(9-10)14-6-5-13-11/h1-4,9,15H,5-8H2/b2-1+ |
| InChIKey | XYKYMPNFVFMGFT-OWOJBTEDSA-N |
| XLogP | 3.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|