About [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol
[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol (PubChem CID 115479524) has the molecular formula C16H22O2S2
and a molecular weight of 310.48 g/mol. Its IUPAC name is [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol.
Molecular Properties
| Compound Name | [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol |
| PubChem CID | 115479524 |
| Molecular Formula | C16H22O2S2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol |
| SMILES | SCC1(CSc2ccc3c(c2)OCCO3)CCCCC1 |
| InChI | InChI=1S/C16H22O2S2/c19-11-16(6-2-1-3-7-16)12-20-13-4-5-14-15(10-13)18-9-8-17-14/h4-5,10,19H,1-3,6-9,11-12H2 |
| InChIKey | QMUGNLIPHMSHLD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol?
The IUPAC name of [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol (CID 115479524) is [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol.
What is the SMILES notation for [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol?
The canonical SMILES for [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol is SCC1(CSc2ccc3c(c2)OCCO3)CCCCC1.
What is the InChIKey of [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol?
The InChIKey is QMUGNLIPHMSHLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2S2/c19-11-16(6-2-1-3-7-16)12-20-13-4-5-14-15(10-13)18-9-8-17-14/h4-5,10,19H,1-3,6-9,11-12H2.
What are the key properties of [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol?
[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol has a molecular weight of 310.48 g/mol, XLogP of 4.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)cyclohexyl]methanethiol is sourced from PubChem (CID 115479524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).