C15H20O3S — CID 113434087
6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)hexan-3-one (PubChem CID 113434087) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)hexan-3-one.
| Compound Name | 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)hexan-3-one |
|---|---|
| PubChem CID | 113434087 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)hexan-3-one |
| SMILES | CCC(=O)CCCSc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C15H20O3S/c1-2-12(16)5-3-10-19-13-6-7-14-15(11-13)18-9-4-8-17-14/h6-7,11H,2-5,8-10H2,1H3 |
| InChIKey | XKZVMIVYQOJBID-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|